C21H18BrNO4 — CID 4682103
9-bromo-1-ethyl-3-(4-methylphenyl)-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione (PubChem CID 4682103) has the molecular formula C21H18BrNO4 and a molecular weight of 428.28 g/mol. Its IUPAC name is 9-bromo-1-ethyl-3-(4-methylphenyl)-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione.
| Compound Name | 9-bromo-1-ethyl-3-(4-methylphenyl)-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione |
|---|---|
| PubChem CID | 4682103 |
| Molecular Formula | C21H18BrNO4 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 9-bromo-1-ethyl-3-(4-methylphenyl)-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione |
| SMILES | CCC1C(=O)N(c2ccc(C)cc2)C(=O)C2C(=O)Oc3ccc(Br)cc3C12 |
| InChI | InChI=1S/C21H18BrNO4/c1-3-14-17-15-10-12(22)6-9-16(15)27-21(26)18(17)20(25)23(19(14)24)13-7-4-11(2)5-8-13/h4-10,14,17-18H,3H2,1-2H3 |
| InChIKey | JYGFBQOMAKQUPL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|