C26H22N4O2S — CID 46821334
N-[4-(cyanomethyl)phenyl]-2-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 46821334) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46821334 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CCc1ccc(-n2c(SCC(=O)Nc3ccc(CC#N)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H22N4O2S/c1-2-18-9-13-21(14-10-18)30-25(32)22-5-3-4-6-23(22)29-26(30)33-17-24(31)28-20-11-7-19(8-12-20)15-16-27/h3-14H,2,15,17H2,1H3,(H,28,31) |
| InChIKey | GYQDSXJRFOGBBS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |