C23H25F2N5O2S — CID 46821599
2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide (PubChem CID 46821599) has the molecular formula C23H25F2N5O2S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide.
| Compound Name | 2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 46821599 |
| Molecular Formula | C23H25F2N5O2S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CSc1nnc(-c2ccc(OC(F)F)cc2)n1N)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H25F2N5O2S/c1-14(17-7-6-15-4-2-3-5-18(15)12-17)27-20(31)13-33-23-29-28-21(30(23)26)16-8-10-19(11-9-16)32-22(24)25/h6-12,14,22H,2-5,13,26H2,1H3,(H,27,31) |
| InChIKey | QBMKUHNNZBWAEB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |