C22H19N7O3 — CID 46822486
[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 46822486) has the molecular formula C22H19N7O3 and a molecular weight of 429.44 g/mol. Its IUPAC name is [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 46822486 |
| Molecular Formula | C22H19N7O3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1ccccc1Nc1nc(N)nc(COC(=O)c2c(C)oc(-n3cccc3)c2C#N)n1 |
| InChI | InChI=1S/C22H19N7O3/c1-13-7-3-4-8-16(13)25-22-27-17(26-21(24)28-22)12-31-20(30)18-14(2)32-19(15(18)11-23)29-9-5-6-10-29/h3-10H,12H2,1-2H3,(H3,24,25,26,27,28) |
| InChIKey | NJBJRNWBFCANNF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 144.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|