C11H14N2O5 — CID 46822727
[1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate (PubChem CID 46822727) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate.
| Compound Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 46822727 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-methylfuran-3-carboxylate |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1ccoc1C |
| InChI | InChI=1S/C11H14N2O5/c1-6-8(4-5-17-6)10(15)18-7(2)9(14)13-11(16)12-3/h4-5,7H,1-3H3,(H2,12,13,14,16) |
| InChIKey | AMTGNRLWFZZIOU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |