C23H23N5OS3 — CID 46822979
2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 46822979) has the molecular formula C23H23N5OS3 and a molecular weight of 481.67 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 46822979 |
| Molecular Formula | C23H23N5OS3 |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)CSc3nnc(-c4cccs4)n3C3CC3)n2)c(C)c1 |
| InChI | InChI=1S/C23H23N5OS3/c1-13-9-14(2)20(15(3)10-13)17-11-31-22(24-17)25-19(29)12-32-23-27-26-21(18-5-4-8-30-18)28(23)16-6-7-16/h4-5,8-11,16H,6-7,12H2,1-3H3,(H,24,25,29) |
| InChIKey | RPARUFQIUWCJHA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |