C17H20N2OS — CID 46823386
N-cyclohexyl-N-methyl-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 46823386) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclohexyl-N-methyl-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46823386 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(C(=O)c1csc(-c2ccccc2)n1)C1CCCCC1 |
| InChI | InChI=1S/C17H20N2OS/c1-19(14-10-6-3-7-11-14)17(20)15-12-21-16(18-15)13-8-4-2-5-9-13/h2,4-5,8-9,12,14H,3,6-7,10-11H2,1H3 |
| InChIKey | CQSNGZIYKVRELK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |