C20H22BrFN2O3S — CID 46823524
2-[(2-bromo-4-fluorobenzoyl)amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 46823524) has the molecular formula C20H22BrFN2O3S and a molecular weight of 469.38 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorobenzoyl)amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(2-bromo-4-fluorobenzoyl)amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 46823524 |
| Molecular Formula | C20H22BrFN2O3S |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-[(2-bromo-4-fluorobenzoyl)amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCCNC(=O)c1c(NC(=O)c2ccc(F)cc2Br)sc2c1CCCC2 |
| InChI | InChI=1S/C20H22BrFN2O3S/c1-27-10-4-9-23-19(26)17-14-5-2-3-6-16(14)28-20(17)24-18(25)13-8-7-12(22)11-15(13)21/h7-8,11H,2-6,9-10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | LIRWFPQVFLLCTP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|