C22H23N3O4S2 — CID 46823616
N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 46823616) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46823616 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(4-ethoxy-3-pyrrolidin-1-ylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C22H23N3O4S2/c1-2-29-19-11-10-17(14-20(19)31(27,28)25-12-6-7-13-25)23-21(26)18-15-30-22(24-18)16-8-4-3-5-9-16/h3-5,8-11,14-15H,2,6-7,12-13H2,1H3,(H,23,26) |
| InChIKey | MLWLVSGNQUIKLO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |