C19H17N7O4S — CID 46824502
2-[1-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 46824502) has the molecular formula C19H17N7O4S and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[1-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[1-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 46824502 |
| Molecular Formula | C19H17N7O4S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[1-[1-(2-methoxy-5-methylphenyl)tetrazol-5-yl]sulfanylethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(C)cc1-n1nnnc1SC(C)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H17N7O4S/c1-11-4-9-16(29-3)15(10-11)25-19(22-23-24-25)31-12(2)17-20-21-18(30-17)13-5-7-14(8-6-13)26(27)28/h4-10,12H,1-3H3 |
| InChIKey | MNUNTTGPWPIXIW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 134.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|