About 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate
1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 46824605) has the molecular formula C22H23BrN2O5
and a molecular weight of 475.34 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate.
Molecular Properties
| Compound Name | 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate |
| PubChem CID | 46824605 |
| Molecular Formula | C22H23BrN2O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)OC(C)c2nnc(-c3ccc(C)cc3)o2)cc1OC |
| InChI | InChI=1S/C22H23BrN2O5/c1-5-10-28-19-17(23)11-16(12-18(19)27-4)22(26)29-14(3)20-24-25-21(30-20)15-8-6-13(2)7-9-15/h6-9,11-12,14H,5,10H2,1-4H3 |
| InChIKey | DKRZLKXFUTUGRM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate?
The IUPAC name of 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate (CID 46824605) is 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate.
What is the SMILES notation for 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate?
The canonical SMILES for 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate is CCCOc1c(Br)cc(C(=O)OC(C)c2nnc(-c3ccc(C)cc3)o2)cc1OC.
What is the InChIKey of 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate?
The InChIKey is DKRZLKXFUTUGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23BrN2O5/c1-5-10-28-19-17(23)11-16(12-18(19)27-4)22(26)29-14(3)20-24-25-21(30-20)15-8-6-13(2)7-9-15/h6-9,11-12,14H,5,10H2,1-4H3.
What are the key properties of 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate?
1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate has a molecular weight of 475.34 g/mol, XLogP of 5.52, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-bromo-5-methoxy-4-propoxybenzoate is sourced from PubChem (CID 46824605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).