C24H22N2O2 — CID 4682478
N-[(2-oxopyrrolidin-1-yl)methyl]-N,4-diphenylbenzamide (PubChem CID 4682478) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(2-oxopyrrolidin-1-yl)methyl]-N,4-diphenylbenzamide.
| Compound Name | N-[(2-oxopyrrolidin-1-yl)methyl]-N,4-diphenylbenzamide |
|---|---|
| PubChem CID | 4682478 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[(2-oxopyrrolidin-1-yl)methyl]-N,4-diphenylbenzamide |
| SMILES | O=C1CCCN1CN(C(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c27-23-12-7-17-25(23)18-26(22-10-5-2-6-11-22)24(28)21-15-13-20(14-16-21)19-8-3-1-4-9-19/h1-6,8-11,13-16H,7,12,17-18H2 |
| InChIKey | PDQQPRBVNVKFIY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |