C20H24FNO — CID 46828416
N-[1-(4-fluorophenyl)-2-methylpropyl]-3-phenylbutanamide (PubChem CID 46828416) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-methylpropyl]-3-phenylbutanamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-methylpropyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 46828416 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-methylpropyl]-3-phenylbutanamide |
| SMILES | CC(CC(=O)NC(c1ccc(F)cc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H24FNO/c1-14(2)20(17-9-11-18(21)12-10-17)22-19(23)13-15(3)16-7-5-4-6-8-16/h4-12,14-15,20H,13H2,1-3H3,(H,22,23) |
| InChIKey | HURGKEBQCUVTLC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |