C19H20F6N4O2 — CID 46829278
1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-morpholin-4-ylethylamino)pyrimidin-5-yl]phenyl]propan-2-ol (PubChem CID 46829278) has the molecular formula C19H20F6N4O2 and a molecular weight of 450.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-morpholin-4-ylethylamino)pyrimidin-5-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-morpholin-4-ylethylamino)pyrimidin-5-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 46829278 |
| Molecular Formula | C19H20F6N4O2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-morpholin-4-ylethylamino)pyrimidin-5-yl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2cnc(NCCN3CCOCC3)nc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H20F6N4O2/c20-18(21,22)17(30,19(23,24)25)15-3-1-13(2-4-15)14-11-27-16(28-12-14)26-5-6-29-7-9-31-10-8-29/h1-4,11-12,30H,5-10H2,(H,26,27,28) |
| InChIKey | GSQKHFRAFSPIFZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |