C36H30F12N2O2 — CID 46829284
1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 46829284) has the molecular formula C36H30F12N2O2 and a molecular weight of 750.62 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 46829284 |
| Molecular Formula | C36H30F12N2O2 |
| Molecular Weight | 750.62 g/mol |
| Exact Mass | 750.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCN(Cc4ccc(-c5ccc(C(O)(C(F)(F)F)C(F)(F)F)cc5)cc4)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C36H30F12N2O2/c37-33(38,39)31(51,34(40,41)42)29-13-9-27(10-14-29)25-5-1-23(2-6-25)21-49-17-19-50(20-18-49)22-24-3-7-26(8-4-24)28-11-15-30(16-12-28)32(52,35(43,44)45)36(46,47)48/h1-16,51-52H,17-22H2 |
| InChIKey | TVYHPPKEVCROKK-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.62 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |