About 2-nitro-1,3-diphenylprop-2-en-1-one
2-nitro-1,3-diphenylprop-2-en-1-one (PubChem CID 4683026) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-nitro-1,3-diphenylprop-2-en-1-one.
Molecular Properties
| Compound Name | 2-nitro-1,3-diphenylprop-2-en-1-one |
| PubChem CID | 4683026 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-nitro-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccccc1)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H11NO3/c17-15(13-9-5-2-6-10-13)14(16(18)19)11-12-7-3-1-4-8-12/h1-11H |
| InChIKey | YUFZFDCSLAUIPS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1,3-diphenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1,3-diphenylprop-2-en-1-one?
The IUPAC name of 2-nitro-1,3-diphenylprop-2-en-1-one (CID 4683026) is 2-nitro-1,3-diphenylprop-2-en-1-one.
What is the SMILES notation for 2-nitro-1,3-diphenylprop-2-en-1-one?
The canonical SMILES for 2-nitro-1,3-diphenylprop-2-en-1-one is O=C(C(=Cc1ccccc1)[N+](=O)[O-])c1ccccc1.
What is the InChIKey of 2-nitro-1,3-diphenylprop-2-en-1-one?
The InChIKey is YUFZFDCSLAUIPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3/c17-15(13-9-5-2-6-10-13)14(16(18)19)11-12-7-3-1-4-8-12/h1-11H.
What are the key properties of 2-nitro-1,3-diphenylprop-2-en-1-one?
2-nitro-1,3-diphenylprop-2-en-1-one has a molecular weight of 253.26 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1,3-diphenylprop-2-en-1-one is sourced from PubChem (CID 4683026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).