C31H42O2 — CID 46830356
(2-propan-2-ylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 46830356) has the molecular formula C31H42O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (2-propan-2-ylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 46830356 |
| Molecular Formula | C31H42O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (2-propan-2-ylphenyl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C31H42O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-31(32)33-30-26-24-23-25-29(30)28(2)3/h5-6,8-9,11-12,14-15,17-18,20-21,23-26,28H,4,7,10,13,16,19,22,27H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | FNOXYRWLTCYICQ-YNUSHXQLSA-N |
| XLogP | 9.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|