C23H21FN4O4S — CID 46830420
N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide (PubChem CID 46830420) has the molecular formula C23H21FN4O4S and a molecular weight of 468.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46830420 |
| Molecular Formula | C23H21FN4O4S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
| SMILES | O=C(CCCCCn1cc(C(=O)Nc2nc3ccccc3s2)c(=O)c2cc(F)ccc21)NO |
| InChI | InChI=1S/C23H21FN4O4S/c24-14-9-10-18-15(12-14)21(30)16(13-28(18)11-5-1-2-8-20(29)27-32)22(31)26-23-25-17-6-3-4-7-19(17)33-23/h3-4,6-7,9-10,12-13,32H,1-2,5,8,11H2,(H,27,29)(H,25,26,31) |
| InChIKey | NXPPBSCLWJCJKL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|