C22H24BrNO3 — CID 46830456
(6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[(2-methyloxiran-2-yl)methyl]-6-phenyl-1,3-oxazinan-2-one (PubChem CID 46830456) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is (6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[(2-methyloxiran-2-yl)methyl]-6-phenyl-1,3-oxazinan-2-one.
| Compound Name | (6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[(2-methyloxiran-2-yl)methyl]-6-phenyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 46830456 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[(2-methyloxiran-2-yl)methyl]-6-phenyl-1,3-oxazinan-2-one |
| SMILES | C[C@@H](c1ccc(Br)cc1)N1CC[C@](CC2(C)CO2)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C22H24BrNO3/c1-16(17-8-10-19(23)11-9-17)24-13-12-22(27-20(24)25,14-21(2)15-26-21)18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3/t16-,21?,22-/m0/s1 |
| InChIKey | JTNWKEDAWRLGSI-URJRECBDSA-N |
| XLogP | 5.43 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|