C18H30O4 — CID 46830514
(3E,4R,5S)-3-dodec-11-enylidene-4-hydroxy-5-methoxy-5-methyloxolan-2-one (PubChem CID 46830514) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (3E,4R,5S)-3-dodec-11-enylidene-4-hydroxy-5-methoxy-5-methyloxolan-2-one.
| Compound Name | (3E,4R,5S)-3-dodec-11-enylidene-4-hydroxy-5-methoxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 46830514 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3E,4R,5S)-3-dodec-11-enylidene-4-hydroxy-5-methoxy-5-methyloxolan-2-one |
| SMILES | C=CCCCCCCCCC/C=C1/C(=O)O[C@](C)(OC)[C@@H]1O |
| InChI | InChI=1S/C18H30O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(19)18(2,21-3)22-17(15)20/h4,14,16,19H,1,5-13H2,2-3H3/b15-14+/t16-,18+/m1/s1 |
| InChIKey | WBGZYWAQSKEEGP-HTKCQIJRSA-N |
| XLogP | 3.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|