C24H32O6 — CID 46830762
[(1R,3E,5S,10R)-1-acetyloxy-3,17,17-trimethyl-7-methylidene-14-oxo-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate (PubChem CID 46830762) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(1R,3E,5S,10R)-1-acetyloxy-3,17,17-trimethyl-7-methylidene-14-oxo-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate.
| Compound Name | [(1R,3E,5S,10R)-1-acetyloxy-3,17,17-trimethyl-7-methylidene-14-oxo-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate |
|---|---|
| PubChem CID | 46830762 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(1R,3E,5S,10R)-1-acetyloxy-3,17,17-trimethyl-7-methylidene-14-oxo-15-oxatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate |
| SMILES | C=C1CC[C@@H]2CCC3=C(C2(C)C)[C@@](OC(C)=O)(C/C(C)=C/[C@@H](OC(C)=O)C1)OC3=O |
| InChI | InChI=1S/C24H32O6/c1-14-7-8-18-9-10-20-21(23(18,5)6)24(29-17(4)26,30-22(20)27)13-15(2)12-19(11-14)28-16(3)25/h12,18-19H,1,7-11,13H2,2-6H3/b15-12+/t18-,19+,24-/m1/s1 |
| InChIKey | KMGLUZHXMROETR-AUWSHUIWSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|