C16H16N2O3S — CID 46830792
1-[2-[(2S)-oxiran-2-yl]ethyl]-3-phenyl-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 46830792) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-[2-[(2S)-oxiran-2-yl]ethyl]-3-phenyl-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 1-[2-[(2S)-oxiran-2-yl]ethyl]-3-phenyl-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 46830792 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-[2-[(2S)-oxiran-2-yl]ethyl]-3-phenyl-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | O=S1(=O)N(CC[C@H]2CO2)c2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O3S/c19-22(20)17(11-10-14-12-21-14)15-8-4-5-9-16(15)18(22)13-6-2-1-3-7-13/h1-9,14H,10-12H2/t14-/m0/s1 |
| InChIKey | XIUWFXQQRPCQJU-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|