C13H20O5S2 — CID 46831022
[(2R,3S,6R)-3-acetyloxy-6-(3-sulfanylpropylsulfanyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 46831022) has the molecular formula C13H20O5S2 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-(3-sulfanylpropylsulfanyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-(3-sulfanylpropylsulfanyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46831022 |
| Molecular Formula | C13H20O5S2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-(3-sulfanylpropylsulfanyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SCCCS)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20O5S2/c1-9(14)16-8-12-11(17-10(2)15)4-5-13(18-12)20-7-3-6-19/h4-5,11-13,19H,3,6-8H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | CIXRJSCPOUZNSF-YNEHKIRRSA-N |
| XLogP | 1.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|