C20H22O7 — CID 46831543
[(1R,5R,6S)-5,6-diacetyloxy-3-(4-methylbenzoyl)cyclohex-3-en-1-yl] acetate (PubChem CID 46831543) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(1R,5R,6S)-5,6-diacetyloxy-3-(4-methylbenzoyl)cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,5R,6S)-5,6-diacetyloxy-3-(4-methylbenzoyl)cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 46831543 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(1R,5R,6S)-5,6-diacetyloxy-3-(4-methylbenzoyl)cyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)C=C(C(=O)c2ccc(C)cc2)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H22O7/c1-11-5-7-15(8-6-11)19(24)16-9-17(25-12(2)21)20(27-14(4)23)18(10-16)26-13(3)22/h5-9,17-18,20H,10H2,1-4H3/t17-,18-,20-/m1/s1 |
| InChIKey | DABPATSTYGCWMF-QWFCFKBJSA-N |
| XLogP | 2.30 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|