C22H25N5O2 — CID 46831796
2-[4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperazin-1-yl]ethanol (PubChem CID 46831796) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-[4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 46831796 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2cccnc2Oc2ccc(Nc3ccccn3)cc2)CC1 |
| InChI | InChI=1S/C22H25N5O2/c28-17-16-26-12-14-27(15-13-26)20-4-3-11-24-22(20)29-19-8-6-18(7-9-19)25-21-5-1-2-10-23-21/h1-11,28H,12-17H2,(H,23,25) |
| InChIKey | IXXZWVVVDONLGV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |