C24H33NO2 — CID 46831975
methyl 3-[(1S,2R,3R)-2-(1H-indol-3-ylmethyl)-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate (PubChem CID 46831975) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is methyl 3-[(1S,2R,3R)-2-(1H-indol-3-ylmethyl)-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate.
| Compound Name | methyl 3-[(1S,2R,3R)-2-(1H-indol-3-ylmethyl)-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate |
|---|---|
| PubChem CID | 46831975 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | methyl 3-[(1S,2R,3R)-2-(1H-indol-3-ylmethyl)-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate |
| SMILES | COC(=O)CC[C@@H]1C(=C(C)C)CC[C@@H](C)[C@@]1(C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H33NO2/c1-16(2)19-11-10-17(3)24(4,21(19)12-13-23(26)27-5)14-18-15-25-22-9-7-6-8-20(18)22/h6-9,15,17,21,25H,10-14H2,1-5H3/t17-,21-,24-/m1/s1 |
| InChIKey | WEVPJDIZBLFOEP-NYQDVAGCSA-N |
| XLogP | 6.05 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|