C16H24O6S — CID 46832457
[(4S,5S)-5-[(2R)-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 46832457) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is [(4S,5S)-5-[(2R)-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4S,5S)-5-[(2R)-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46832457 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [(4S,5S)-5-[(2R)-2-hydroxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2OC(C)(C)O[C@H]2C[C@@H](C)O)cc1 |
| InChI | InChI=1S/C16H24O6S/c1-11-5-7-13(8-6-11)23(18,19)20-10-15-14(9-12(2)17)21-16(3,4)22-15/h5-8,12,14-15,17H,9-10H2,1-4H3/t12-,14+,15+/m1/s1 |
| InChIKey | XIRSOSLHKJYOJU-SNPRPXQTSA-N |
| XLogP | 1.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|