C19H27NO6 — CID 46832818
1-O-methyl 4-O-[(1S,3R,5R,6S)-8-methyl-6-[(E)-2-methylbut-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (Z)-2-methylbut-2-enedioate (PubChem CID 46832818) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(1S,3R,5R,6S)-8-methyl-6-[(E)-2-methylbut-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (Z)-2-methylbut-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(1S,3R,5R,6S)-8-methyl-6-[(E)-2-methylbut-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (Z)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 46832818 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-O-methyl 4-O-[(1S,3R,5R,6S)-8-methyl-6-[(E)-2-methylbut-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (Z)-2-methylbut-2-enedioate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@@H]2C[C@@H](OC(=O)/C=C(/C)C(=O)OC)C[C@H]1N2C |
| InChI | InChI=1S/C19H27NO6/c1-6-11(2)19(23)26-16-9-13-8-14(10-15(16)20(13)4)25-17(21)7-12(3)18(22)24-5/h6-7,13-16H,8-10H2,1-5H3/b11-6+,12-7-/t13-,14+,15+,16-/m0/s1 |
| InChIKey | HTJMXYOKUGEWDB-OPRNIGSSSA-N |
| XLogP | 1.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|