C26H32F3N5O3S2 — CID 46832851
N-[2-amino-4-(trifluoromethyl)phenyl]-N'-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]octanediamide (PubChem CID 46832851) has the molecular formula C26H32F3N5O3S2 and a molecular weight of 583.70 g/mol. Its IUPAC name is N-[2-amino-4-(trifluoromethyl)phenyl]-N'-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]octanediamide.
| Compound Name | N-[2-amino-4-(trifluoromethyl)phenyl]-N'-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]octanediamide |
|---|---|
| PubChem CID | 46832851 |
| Molecular Formula | C26H32F3N5O3S2 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | N-[2-amino-4-(trifluoromethyl)phenyl]-N'-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]octanediamide |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(NC(=O)CCCCCCC(=O)Nc3ccc(C(F)(F)F)cc3N)s2)o1 |
| InChI | InChI=1S/C26H32F3N5O3S2/c1-25(2,3)19-13-31-22(37-19)15-38-23-14-32-24(39-23)34-21(36)9-7-5-4-6-8-20(35)33-18-11-10-16(12-17(18)30)26(27,28)29/h10-14H,4-9,15,30H2,1-3H3,(H,33,35)(H,32,34,36) |
| InChIKey | RKAJNOSTWBEIKK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|