C19H18N2O2 — CID 46833032
7,9-dimethyl-2-phenyl-4-prop-2-enyl-1,4-diazaspiro[4.5]deca-1,6,9-triene-3,8-dione (PubChem CID 46833032) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 7,9-dimethyl-2-phenyl-4-prop-2-enyl-1,4-diazaspiro[4.5]deca-1,6,9-triene-3,8-dione.
| Compound Name | 7,9-dimethyl-2-phenyl-4-prop-2-enyl-1,4-diazaspiro[4.5]deca-1,6,9-triene-3,8-dione |
|---|---|
| PubChem CID | 46833032 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 7,9-dimethyl-2-phenyl-4-prop-2-enyl-1,4-diazaspiro[4.5]deca-1,6,9-triene-3,8-dione |
| SMILES | C=CCN1C(=O)C(c2ccccc2)=NC12C=C(C)C(=O)C(C)=C2 |
| InChI | InChI=1S/C19H18N2O2/c1-4-10-21-18(23)16(15-8-6-5-7-9-15)20-19(21)11-13(2)17(22)14(3)12-19/h4-9,11-12H,1,10H2,2-3H3 |
| InChIKey | QEGPWPRMDZFEFF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|