About 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline
4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline (PubChem CID 46833054) has the molecular formula C21H9F9N4O6
and a molecular weight of 584.31 g/mol. Its IUPAC name is 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
| PubChem CID | 46833054 |
| Molecular Formula | C21H9F9N4O6 |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H9F9N4O6/c22-19(23,24)13-7-10(1-4-16(13)32(35)36)31(11-2-5-17(33(37)38)14(8-11)20(25,26)27)12-3-6-18(34(39)40)15(9-12)21(28,29)30/h1-9H |
| InChIKey | UOWSBUXCCWTFOQ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline?
The IUPAC name of 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline (CID 46833054) is 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline.
What is the SMILES notation for 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline?
The canonical SMILES for 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline is O=[N+]([O-])c1ccc(N(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1C(F)(F)F.
What is the InChIKey of 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline?
The InChIKey is UOWSBUXCCWTFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H9F9N4O6/c22-19(23,24)13-7-10(1-4-16(13)32(35)36)31(11-2-5-17(33(37)38)14(8-11)20(25,26)27)12-3-6-18(34(39)40)15(9-12)21(28,29)30/h1-9H.
What are the key properties of 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline?
4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline has a molecular weight of 584.31 g/mol, XLogP of 7.94, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N,N-bis[4-nitro-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline is sourced from PubChem (CID 46833054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).