C22H34O5 — CID 46833118
[(1R,2R,5S,8R,9S,10R,13R,14R)-5-hydroxy-2,10-dimethyl-6-methylidene-13-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,5.09,14]hexadecan-10-yl] acetate (PubChem CID 46833118) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1R,2R,5S,8R,9S,10R,13R,14R)-5-hydroxy-2,10-dimethyl-6-methylidene-13-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,5.09,14]hexadecan-10-yl] acetate.
| Compound Name | [(1R,2R,5S,8R,9S,10R,13R,14R)-5-hydroxy-2,10-dimethyl-6-methylidene-13-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,5.09,14]hexadecan-10-yl] acetate |
|---|---|
| PubChem CID | 46833118 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,2R,5S,8R,9S,10R,13R,14R)-5-hydroxy-2,10-dimethyl-6-methylidene-13-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,5.09,14]hexadecan-10-yl] acetate |
| SMILES | C=C1C[C@H]2O[C@H]([C@H]3[C@@H]2[C@](C)(OC(C)=O)CC[C@@H]3C(C)C)[C@@]2(C)CC[C@]1(O)O2 |
| InChI | InChI=1S/C22H34O5/c1-12(2)15-7-8-20(5,26-14(4)23)18-16-11-13(3)22(24)10-9-21(6,27-22)19(25-16)17(15)18/h12,15-19,24H,3,7-11H2,1-2,4-6H3/t15-,16-,17-,18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | KKHDVLLKJKRJGE-JTQPAYLFSA-N |
| XLogP | 3.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|