C22H32O4 — CID 46833124
[(3aR,5S,10S,12aS)-3a,10-dimethyl-6-methylidene-2,9-dioxo-1-propan-2-ylidene-4,5,7,8,10,11,12,12a-octahydro-3H-cyclopenta[11]annulen-5-yl] acetate (PubChem CID 46833124) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(3aR,5S,10S,12aS)-3a,10-dimethyl-6-methylidene-2,9-dioxo-1-propan-2-ylidene-4,5,7,8,10,11,12,12a-octahydro-3H-cyclopenta[11]annulen-5-yl] acetate.
| Compound Name | [(3aR,5S,10S,12aS)-3a,10-dimethyl-6-methylidene-2,9-dioxo-1-propan-2-ylidene-4,5,7,8,10,11,12,12a-octahydro-3H-cyclopenta[11]annulen-5-yl] acetate |
|---|---|
| PubChem CID | 46833124 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(3aR,5S,10S,12aS)-3a,10-dimethyl-6-methylidene-2,9-dioxo-1-propan-2-ylidene-4,5,7,8,10,11,12,12a-octahydro-3H-cyclopenta[11]annulen-5-yl] acetate |
| SMILES | C=C1CCC(=O)[C@@H](C)CC[C@@H]2C(=C(C)C)C(=O)C[C@@]2(C)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H32O4/c1-13(2)21-17-9-7-14(3)18(24)10-8-15(4)20(26-16(5)23)12-22(17,6)11-19(21)25/h14,17,20H,4,7-12H2,1-3,5-6H3/t14-,17+,20-,22-/m0/s1 |
| InChIKey | IXUCRSIQKBLIIL-RSGMMRJUSA-N |
| XLogP | 4.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|