C34H37N5O2 — CID 46833239
4-ethoxy-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide (PubChem CID 46833239) has the molecular formula C34H37N5O2 and a molecular weight of 547.70 g/mol. Its IUPAC name is 4-ethoxy-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide.
| Compound Name | 4-ethoxy-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 46833239 |
| Molecular Formula | C34H37N5O2 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 4-ethoxy-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(C3Cc4cnc(NCCCN5CCCC5)nc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C34H37N5O2/c1-2-41-28-16-12-25(13-17-28)33(40)37-27-14-10-24(11-15-27)31-22-26-23-36-34(35-18-7-21-39-19-5-6-20-39)38-32(26)30-9-4-3-8-29(30)31/h3-4,8-17,23,31H,2,5-7,18-22H2,1H3,(H,37,40)(H,35,36,38) |
| InChIKey | ICNJEZGABNQAFH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|