C16H15FN2O2S — CID 46833384
1-but-3-enyl-3-(2-fluorophenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 46833384) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-but-3-enyl-3-(2-fluorophenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 1-but-3-enyl-3-(2-fluorophenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 46833384 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-but-3-enyl-3-(2-fluorophenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | C=CCCN1c2ccccc2N(c2ccccc2F)S1(=O)=O |
| InChI | InChI=1S/C16H15FN2O2S/c1-2-3-12-18-15-10-6-7-11-16(15)19(22(18,20)21)14-9-5-4-8-13(14)17/h2,4-11H,1,3,12H2 |
| InChIKey | GOXMANJZSLDVCU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|