C20H28O3 — CID 46833405
(4aS,4bR,7S,10aR)-7-ethenyl-8a-hydroxy-1,1,4a,7-tetramethyl-4b,5,8,9,10,10a-hexahydrophenanthrene-2,6-dione (PubChem CID 46833405) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4aS,4bR,7S,10aR)-7-ethenyl-8a-hydroxy-1,1,4a,7-tetramethyl-4b,5,8,9,10,10a-hexahydrophenanthrene-2,6-dione.
| Compound Name | (4aS,4bR,7S,10aR)-7-ethenyl-8a-hydroxy-1,1,4a,7-tetramethyl-4b,5,8,9,10,10a-hexahydrophenanthrene-2,6-dione |
|---|---|
| PubChem CID | 46833405 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4aS,4bR,7S,10aR)-7-ethenyl-8a-hydroxy-1,1,4a,7-tetramethyl-4b,5,8,9,10,10a-hexahydrophenanthrene-2,6-dione |
| SMILES | C=C[C@]1(C)CC2(O)CC[C@H]3C(C)(C)C(=O)C=C[C@]3(C)[C@H]2CC1=O |
| InChI | InChI=1S/C20H28O3/c1-6-18(4)12-20(23)10-7-13-17(2,3)15(21)8-9-19(13,5)14(20)11-16(18)22/h6,8-9,13-14,23H,1,7,10-12H2,2-5H3/t13-,14+,18+,19-,20?/m0/s1 |
| InChIKey | MFCIBZRSHPNCSK-DTQYSHRGSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|