C20H30O3 — CID 46833412
(3aS,5Z,9R,10E,12aR)-9-hydroperoxy-3a,6,10-trimethyl-1-propan-2-yl-4,7,8,9,12,12a-hexahydrocyclopenta[11]annulen-3-one (PubChem CID 46833412) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3aS,5Z,9R,10E,12aR)-9-hydroperoxy-3a,6,10-trimethyl-1-propan-2-yl-4,7,8,9,12,12a-hexahydrocyclopenta[11]annulen-3-one.
| Compound Name | (3aS,5Z,9R,10E,12aR)-9-hydroperoxy-3a,6,10-trimethyl-1-propan-2-yl-4,7,8,9,12,12a-hexahydrocyclopenta[11]annulen-3-one |
|---|---|
| PubChem CID | 46833412 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3aS,5Z,9R,10E,12aR)-9-hydroperoxy-3a,6,10-trimethyl-1-propan-2-yl-4,7,8,9,12,12a-hexahydrocyclopenta[11]annulen-3-one |
| SMILES | C/C1=C/C[C@]2(C)C(=O)C=C(C(C)C)[C@H]2C/C=C(\C)[C@H](OO)CC1 |
| InChI | InChI=1S/C20H30O3/c1-13(2)16-12-19(21)20(5)11-10-14(3)6-9-18(23-22)15(4)7-8-17(16)20/h7,10,12-13,17-18,22H,6,8-9,11H2,1-5H3/b14-10-,15-7+/t17-,18-,20+/m1/s1 |
| InChIKey | KAXUBHIBOUNYIH-ICCBXIMKSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|