C45H36N3O9P3 — CID 46833945
1,3,5-tris[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 46833945) has the molecular formula C45H36N3O9P3 and a molecular weight of 855.72 g/mol. Its IUPAC name is 1,3,5-tris[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 46833945 |
| Molecular Formula | C45H36N3O9P3 |
| Molecular Weight | 855.72 g/mol |
| Exact Mass | 855.17 |
| IUPAC Name | 1,3,5-tris[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCP2(=O)Oc3ccccc3-c3ccccc32)c(=O)n(CCP2(=O)Oc3ccccc3-c3ccccc32)c(=O)n1CCP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C45H36N3O9P3/c49-43-46(25-28-58(52)40-22-10-4-16-34(40)31-13-1-7-19-37(31)55-58)44(50)48(27-30-60(54)42-24-12-6-18-36(42)33-15-3-9-21-39(33)57-60)45(51)47(43)26-29-59(53)41-23-11-5-17-35(41)32-14-2-8-20-38(32)56-59/h1-24H,25-30H2 |
| InChIKey | CYHKNBGPSPTXIT-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|