C25H23F3N4O3S — CID 46834320
5-(benzenesulfonyl)-8,11,11-trimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 46834320) has the molecular formula C25H23F3N4O3S and a molecular weight of 516.55 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-8,11,11-trimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-(benzenesulfonyl)-8,11,11-trimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 46834320 |
| Molecular Formula | C25H23F3N4O3S |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 5-(benzenesulfonyl)-8,11,11-trimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(cn(Cc3ccc(C(F)(F)F)cc3)c2S(=O)(=O)c2ccccc2)N2CC(C)(C)N=C12 |
| InChI | InChI=1S/C25H23F3N4O3S/c1-24(2)15-32-19-14-31(13-16-9-11-17(12-10-16)25(26,27)28)22(20(19)21(33)30(3)23(32)29-24)36(34,35)18-7-5-4-6-8-18/h4-12,14H,13,15H2,1-3H3 |
| InChIKey | CIMDWXKKAHHMDK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |