About 3-[2-(dimethylamino)ethyl]-1,1-diethylurea
3-[2-(dimethylamino)ethyl]-1,1-diethylurea (PubChem CID 46834516) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[2-(dimethylamino)ethyl]-1,1-diethylurea |
| PubChem CID | 46834516 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCCN(C)C |
| InChI | InChI=1S/C9H21N3O/c1-5-12(6-2)9(13)10-7-8-11(3)4/h5-8H2,1-4H3,(H,10,13) |
| InChIKey | UUASHYLYDGHFEP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(dimethylamino)ethyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(dimethylamino)ethyl]-1,1-diethylurea?
The IUPAC name of 3-[2-(dimethylamino)ethyl]-1,1-diethylurea (CID 46834516) is 3-[2-(dimethylamino)ethyl]-1,1-diethylurea.
What is the SMILES notation for 3-[2-(dimethylamino)ethyl]-1,1-diethylurea?
The canonical SMILES for 3-[2-(dimethylamino)ethyl]-1,1-diethylurea is CCN(CC)C(=O)NCCN(C)C.
What is the InChIKey of 3-[2-(dimethylamino)ethyl]-1,1-diethylurea?
The InChIKey is UUASHYLYDGHFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-5-12(6-2)9(13)10-7-8-11(3)4/h5-8H2,1-4H3,(H,10,13).
What are the key properties of 3-[2-(dimethylamino)ethyl]-1,1-diethylurea?
3-[2-(dimethylamino)ethyl]-1,1-diethylurea has a molecular weight of 187.29 g/mol, XLogP of 0.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dimethylamino)ethyl]-1,1-diethylurea is sourced from PubChem (CID 46834516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).