C24H24N4O3S — CID 46834602
6-(4-benzyl-5-methyl-3-oxo-1H-pyrazol-2-yl)-N-ethyl-N-phenylpyridine-3-sulfonamide (PubChem CID 46834602) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 6-(4-benzyl-5-methyl-3-oxo-1H-pyrazol-2-yl)-N-ethyl-N-phenylpyridine-3-sulfonamide.
| Compound Name | 6-(4-benzyl-5-methyl-3-oxo-1H-pyrazol-2-yl)-N-ethyl-N-phenylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 46834602 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 6-(4-benzyl-5-methyl-3-oxo-1H-pyrazol-2-yl)-N-ethyl-N-phenylpyridine-3-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(-n2[nH]c(C)c(Cc3ccccc3)c2=O)nc1 |
| InChI | InChI=1S/C24H24N4O3S/c1-3-27(20-12-8-5-9-13-20)32(30,31)21-14-15-23(25-17-21)28-24(29)22(18(2)26-28)16-19-10-6-4-7-11-19/h4-15,17,26H,3,16H2,1-2H3 |
| InChIKey | SDFGRSXHEMOMML-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |