About 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one
1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one (PubChem CID 46834941) has the molecular formula C21H20BrNO4
and a molecular weight of 430.30 g/mol. Its IUPAC name is 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one.
Molecular Properties
| Compound Name | 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one |
| PubChem CID | 46834941 |
| Molecular Formula | C21H20BrNO4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one |
| SMILES | COc1cc(Br)c(CC(=O)N2C=CC(=O)CC2c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H20BrNO4/c1-26-19-10-15(17(22)13-20(19)27-2)11-21(25)23-9-8-16(24)12-18(23)14-6-4-3-5-7-14/h3-10,13,18H,11-12H2,1-2H3 |
| InChIKey | FQOROXQYOIEESQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one?
The IUPAC name of 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one (CID 46834941) is 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one.
What is the SMILES notation for 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one?
The canonical SMILES for 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one is COc1cc(Br)c(CC(=O)N2C=CC(=O)CC2c2ccccc2)cc1OC.
What is the InChIKey of 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one?
The InChIKey is FQOROXQYOIEESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BrNO4/c1-26-19-10-15(17(22)13-20(19)27-2)11-21(25)23-9-8-16(24)12-18(23)14-6-4-3-5-7-14/h3-10,13,18H,11-12H2,1-2H3.
What are the key properties of 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one?
1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one has a molecular weight of 430.30 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]-2-phenyl-2,3-dihydropyridin-4-one is sourced from PubChem (CID 46834941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).