C20H21NO5 — CID 46835072
dimethyl 1-[(1R)-1-anilinobut-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 46835072) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is dimethyl 1-[(1R)-1-anilinobut-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[(1R)-1-anilinobut-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 46835072 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | dimethyl 1-[(1R)-1-anilinobut-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | C=CC[C@@H](Nc1ccccc1)C12C=CC(O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C20H21NO5/c1-4-8-15(21-13-9-6-5-7-10-13)20-12-11-14(26-20)16(18(22)24-2)17(20)19(23)25-3/h4-7,9-12,14-15,21H,1,8H2,2-3H3/t14?,15-,20?/m1/s1 |
| InChIKey | OATWETZGGLHRAC-RDYUPDBUSA-N |
| XLogP | 2.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|