C24H23NO5 — CID 46835077
dimethyl 1-[(1S)-1-anilino-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 46835077) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is dimethyl 1-[(1S)-1-anilino-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[(1S)-1-anilino-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 46835077 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | dimethyl 1-[(1S)-1-anilino-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2([C@H](Cc3ccccc3)Nc3ccccc3)C=CC1O2 |
| InChI | InChI=1S/C24H23NO5/c1-28-22(26)20-18-13-14-24(30-18,21(20)23(27)29-2)19(15-16-9-5-3-6-10-16)25-17-11-7-4-8-12-17/h3-14,18-19,25H,15H2,1-2H3/t18?,19-,24?/m0/s1 |
| InChIKey | NNYWXUVSLNQBPS-SZTYLXMGSA-N |
| XLogP | 3.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|