C25H25NO6 — CID 46835099
dimethyl 1-[(1R)-1-(4-methoxyanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 46835099) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is dimethyl 1-[(1R)-1-(4-methoxyanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[(1R)-1-(4-methoxyanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 46835099 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | dimethyl 1-[(1R)-1-(4-methoxyanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2([C@@H](Cc3ccccc3)Nc3ccc(OC)cc3)C=CC1O2 |
| InChI | InChI=1S/C25H25NO6/c1-29-18-11-9-17(10-12-18)26-20(15-16-7-5-4-6-8-16)25-14-13-19(32-25)21(23(27)30-2)22(25)24(28)31-3/h4-14,19-20,26H,15H2,1-3H3/t19?,20-,25?/m1/s1 |
| InChIKey | SVPGVWGNFDUIQX-ABGUIGEDSA-N |
| XLogP | 3.07 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|