About (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride
(3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride (PubChem CID 46835337) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride |
| PubChem CID | 46835337 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride |
| SMILES | Cl.NCC1=C(C2=CC=CCC2)OC=CO1 |
| InChI | InChI=1S/C11H13NO2.ClH/c12-8-10-11(14-7-6-13-10)9-4-2-1-3-5-9;/h1-2,4,6-7H,3,5,8,12H2;1H |
| InChIKey | OFWZOUNIPYWKJO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride?
The IUPAC name of (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride (CID 46835337) is (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride.
What is the SMILES notation for (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride?
The canonical SMILES for (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride is Cl.NCC1=C(C2=CC=CCC2)OC=CO1.
What is the InChIKey of (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride?
The InChIKey is OFWZOUNIPYWKJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c12-8-10-11(14-7-6-13-10)9-4-2-1-3-5-9;/h1-2,4,6-7H,3,5,8,12H2;1H.
What are the key properties of (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride?
(3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 46835337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).