About 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate
3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate (PubChem CID 46835367) has the molecular formula C7H9F3N2O2
and a molecular weight of 210.16 g/mol. Its IUPAC name is 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate |
| PubChem CID | 46835367 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate |
| SMILES | CC[n+]1cc[nH]c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C5H8N2.C2HF3O2/c1-2-7-4-3-6-5-7;3-2(4,5)1(6)7/h3-5H,2H2,1H3;(H,6,7) |
| InChIKey | BWVHVHWMCIBWJE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate?
The IUPAC name of 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate (CID 46835367) is 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate is CC[n+]1cc[nH]c1.O=C([O-])C(F)(F)F.
What is the InChIKey of 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate?
The InChIKey is BWVHVHWMCIBWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C2HF3O2/c1-2-7-4-3-6-5-7;3-2(4,5)1(6)7/h3-5H,2H2,1H3;(H,6,7).
What are the key properties of 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate?
3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate has a molecular weight of 210.16 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 46835367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).