About 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine
5,7-difluoro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 46835422) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 46835422 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CCOc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C9H9F2NO/c10-5-3-6(11)9-7(12)1-2-13-8(9)4-5/h3-4,7H,1-2,12H2 |
| InChIKey | ZJGYMNXLPZADME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine (CID 46835422) is 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine is NC1CCOc2cc(F)cc(F)c21.
What is the InChIKey of 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is ZJGYMNXLPZADME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-5-3-6(11)9-7(12)1-2-13-8(9)4-5/h3-4,7H,1-2,12H2.
What are the key properties of 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine?
5,7-difluoro-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 185.17 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 46835422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).