About 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one
4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (PubChem CID 4683577) has the molecular formula C10H5Cl2F3N4O
and a molecular weight of 325.08 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 4683577 |
| Molecular Formula | C10H5Cl2F3N4O |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(C(F)(F)F)c1/N=N/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H5Cl2F3N4O/c11-4-1-2-5(12)6(3-4)16-17-7-8(10(13,14)15)18-19-9(7)20/h1-3H,(H2,18,19,20)/b17-16+ |
| InChIKey | LBQJJISVTOIWPY-WUKNDPDISA-N |
| XLogP | 4.44 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (CID 4683577) is 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one is O=c1[nH][nH]c(C(F)(F)F)c1/N=N/c1cc(Cl)ccc1Cl.
What is the InChIKey of 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
The InChIKey is LBQJJISVTOIWPY-WUKNDPDISA-N. The full InChI is InChI=1S/C10H5Cl2F3N4O/c11-4-1-2-5(12)6(3-4)16-17-7-8(10(13,14)15)18-19-9(7)20/h1-3H,(H2,18,19,20)/b17-16+.
What are the key properties of 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one has a molecular weight of 325.08 g/mol, XLogP of 4.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dichlorophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 4683577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).