About 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide
4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide (PubChem CID 46836216) has the molecular formula C9H15F3OS2
and a molecular weight of 260.35 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide.
Molecular Properties
| Compound Name | 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide |
| PubChem CID | 46836216 |
| Molecular Formula | C9H15F3OS2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide |
| SMILES | O=S1CCC(CSCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H15F3OS2/c10-9(11,12)3-4-14-7-8-1-5-15(13)6-2-8/h8H,1-7H2 |
| InChIKey | OXKFFZJUWPYIKN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide?
The IUPAC name of 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide (CID 46836216) is 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide.
What is the SMILES notation for 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide?
The canonical SMILES for 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide is O=S1CCC(CSCCC(F)(F)F)CC1.
What is the InChIKey of 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide?
The InChIKey is OXKFFZJUWPYIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3OS2/c10-9(11,12)3-4-14-7-8-1-5-15(13)6-2-8/h8H,1-7H2.
What are the key properties of 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide?
4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide has a molecular weight of 260.35 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3,3-trifluoropropylsulfanylmethyl)thiane 1-oxide is sourced from PubChem (CID 46836216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).